C17H19ClN2O5S2 — CID 98337222
(1S,2S,3S,4R)-3-[4-(5-chlorothiophen-2-yl)sulfonylpiperazine-1-carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 98337222) has the molecular formula C17H19ClN2O5S2 and a molecular weight of 430.94 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-[4-(5-chlorothiophen-2-yl)sulfonylpiperazine-1-carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2S,3S,4R)-3-[4-(5-chlorothiophen-2-yl)sulfonylpiperazine-1-carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98337222 |
| Molecular Formula | C17H19ClN2O5S2 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | (1S,2S,3S,4R)-3-[4-(5-chlorothiophen-2-yl)sulfonylpiperazine-1-carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H](C(=O)N2CCN(S(=O)(=O)c3ccc(Cl)s3)CC2)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C17H19ClN2O5S2/c18-12-3-4-13(26-12)27(24,25)20-7-5-19(6-8-20)16(21)14-10-1-2-11(9-10)15(14)17(22)23/h1-4,10-11,14-15H,5-9H2,(H,22,23)/t10-,11+,14-,15-/m0/s1 |
| InChIKey | FAPJLWGAGCABTC-JLUCKKNBSA-N |
| XLogP | 1.76 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|