C18H25N3O4S — CID 42910389
1-[1-(benzenesulfonyl)piperidine-4-carbonyl]piperidine-3-carboxamide (PubChem CID 42910389) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)piperidine-4-carbonyl]piperidine-3-carboxamide.
| Compound Name | 1-[1-(benzenesulfonyl)piperidine-4-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42910389 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1-[1-(benzenesulfonyl)piperidine-4-carbonyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(C(=O)C2CCN(S(=O)(=O)c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C18H25N3O4S/c19-17(22)15-5-4-10-20(13-15)18(23)14-8-11-21(12-9-14)26(24,25)16-6-2-1-3-7-16/h1-3,6-7,14-15H,4-5,8-13H2,(H2,19,22) |
| InChIKey | RBBJNIOVVQREBP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |