C14H14N4O2S — CID 53335980
N-[2-(pyrrolidine-1-carbonyl)thiophen-3-yl]pyrazine-2-carboxamide (PubChem CID 53335980) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is N-[2-(pyrrolidine-1-carbonyl)thiophen-3-yl]pyrazine-2-carboxamide.
| Compound Name | N-[2-(pyrrolidine-1-carbonyl)thiophen-3-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 53335980 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-[2-(pyrrolidine-1-carbonyl)thiophen-3-yl]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccsc1C(=O)N1CCCC1)c1cnccn1 |
| InChI | InChI=1S/C14H14N4O2S/c19-13(11-9-15-4-5-16-11)17-10-3-8-21-12(10)14(20)18-6-1-2-7-18/h3-5,8-9H,1-2,6-7H2,(H,17,19) |
| InChIKey | CHUJVSUYHRHVPI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |