C20H24N4O2 — CID 108947620
3-[4-(3-methylphenyl)piperazin-1-yl]-3-oxo-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 108947620) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 3-[4-(3-methylphenyl)piperazin-1-yl]-3-oxo-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-[4-(3-methylphenyl)piperazin-1-yl]-3-oxo-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 108947620 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 3-[4-(3-methylphenyl)piperazin-1-yl]-3-oxo-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | Cc1cccc(N2CCN(C(=O)CC(=O)NCc3cccnc3)CC2)c1 |
| InChI | InChI=1S/C20H24N4O2/c1-16-4-2-6-18(12-16)23-8-10-24(11-9-23)20(26)13-19(25)22-15-17-5-3-7-21-14-17/h2-7,12,14H,8-11,13,15H2,1H3,(H,22,25) |
| InChIKey | UDDWVSBGLJAYNM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|