C13H16N2O — CID 143955611
(5Z)-5-methyl-6-(pyridin-3-ylamino)hepta-1,5-dien-4-one (PubChem CID 143955611) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (5Z)-5-methyl-6-(pyridin-3-ylamino)hepta-1,5-dien-4-one.
| Compound Name | (5Z)-5-methyl-6-(pyridin-3-ylamino)hepta-1,5-dien-4-one |
|---|---|
| PubChem CID | 143955611 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (5Z)-5-methyl-6-(pyridin-3-ylamino)hepta-1,5-dien-4-one |
| SMILES | C=CCC(=O)/C(C)=C(/C)Nc1cccnc1 |
| InChI | InChI=1S/C13H16N2O/c1-4-6-13(16)10(2)11(3)15-12-7-5-8-14-9-12/h4-5,7-9,15H,1,6H2,2-3H3/b11-10- |
| InChIKey | BZHJQGBYFCEKGY-KHPPLWFESA-N |
| XLogP | 2.93 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|