C12H15N3O3 — CID 7592760
(2S)-4-oxo-2-(prop-2-enylazaniumyl)-4-(pyridin-3-ylamino)butanoate (PubChem CID 7592760) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is (2S)-4-oxo-2-(prop-2-enylazaniumyl)-4-(pyridin-3-ylamino)butanoate.
| Compound Name | (2S)-4-oxo-2-(prop-2-enylazaniumyl)-4-(pyridin-3-ylamino)butanoate |
|---|---|
| PubChem CID | 7592760 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | (2S)-4-oxo-2-(prop-2-enylazaniumyl)-4-(pyridin-3-ylamino)butanoate |
| SMILES | C=CC[NH2+][C@@H](CC(=O)Nc1cccnc1)C(=O)[O-] |
| InChI | InChI=1S/C12H15N3O3/c1-2-5-14-10(12(17)18)7-11(16)15-9-4-3-6-13-8-9/h2-4,6,8,10,14H,1,5,7H2,(H,15,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | BWJDKSOYBJVIKS-JTQLQIEISA-N |
| XLogP | -1.72 |
| TPSA | 98.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|