C13H16N2O — CID 99633361
(2E,4Z)-4-ethyl-N-pyridin-3-ylhexa-2,4-dienamide (PubChem CID 99633361) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (2E,4Z)-4-ethyl-N-pyridin-3-ylhexa-2,4-dienamide.
| Compound Name | (2E,4Z)-4-ethyl-N-pyridin-3-ylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 99633361 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (2E,4Z)-4-ethyl-N-pyridin-3-ylhexa-2,4-dienamide |
| SMILES | C/C=C(\C=C\C(=O)Nc1cccnc1)CC |
| InChI | InChI=1S/C13H16N2O/c1-3-11(4-2)7-8-13(16)15-12-6-5-9-14-10-12/h3,5-10H,4H2,1-2H3,(H,15,16)/b8-7+,11-3- |
| InChIKey | PQAFCZYGLHRDDG-BSFGFYRWSA-N |
| XLogP | 2.93 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|