C27H37F3N6OS — CID 87621893
1-[2-[[4-(diethylamino)phenyl]carbamothioylamino]ethyl]-1-(2-pyrrolidin-1-ylethyl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 87621893) has the molecular formula C27H37F3N6OS and a molecular weight of 550.70 g/mol. Its IUPAC name is 1-[2-[[4-(diethylamino)phenyl]carbamothioylamino]ethyl]-1-(2-pyrrolidin-1-ylethyl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-[[4-(diethylamino)phenyl]carbamothioylamino]ethyl]-1-(2-pyrrolidin-1-ylethyl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 87621893 |
| Molecular Formula | C27H37F3N6OS |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | 1-[2-[[4-(diethylamino)phenyl]carbamothioylamino]ethyl]-1-(2-pyrrolidin-1-ylethyl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CCN(CC)c1ccc(NC(=S)NCCN(CCN2CCCC2)C(=O)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H37F3N6OS/c1-3-35(4-2)24-13-11-22(12-14-24)32-25(38)31-15-18-36(20-19-34-16-5-6-17-34)26(37)33-23-9-7-21(8-10-23)27(28,29)30/h7-14H,3-6,15-20H2,1-2H3,(H,33,37)(H2,31,32,38) |
| InChIKey | WUIMGNZEXDWALC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|