C17H26N4O4 — CID 141120609
2-[(4-methoxyphenyl)carbamoyl-(2-pyrrolidin-1-ylethyl)amino]ethylcarbamic acid (PubChem CID 141120609) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)carbamoyl-(2-pyrrolidin-1-ylethyl)amino]ethylcarbamic acid.
| Compound Name | 2-[(4-methoxyphenyl)carbamoyl-(2-pyrrolidin-1-ylethyl)amino]ethylcarbamic acid |
|---|---|
| PubChem CID | 141120609 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-[(4-methoxyphenyl)carbamoyl-(2-pyrrolidin-1-ylethyl)amino]ethylcarbamic acid |
| SMILES | COc1ccc(NC(=O)N(CCNC(=O)O)CCN2CCCC2)cc1 |
| InChI | InChI=1S/C17H26N4O4/c1-25-15-6-4-14(5-7-15)19-16(22)21(11-8-18-17(23)24)13-12-20-9-2-3-10-20/h4-7,18H,2-3,8-13H2,1H3,(H,19,22)(H,23,24) |
| InChIKey | JCIYWWVSKJUEMO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |