C14H21BrN4O2 — CID 119508627
3-[(4-bromophenyl)carbamoylamino]-N-[2-(ethylamino)ethyl]propanamide (PubChem CID 119508627) has the molecular formula C14H21BrN4O2 and a molecular weight of 357.25 g/mol. Its IUPAC name is 3-[(4-bromophenyl)carbamoylamino]-N-[2-(ethylamino)ethyl]propanamide.
| Compound Name | 3-[(4-bromophenyl)carbamoylamino]-N-[2-(ethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 119508627 |
| Molecular Formula | C14H21BrN4O2 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 3-[(4-bromophenyl)carbamoylamino]-N-[2-(ethylamino)ethyl]propanamide |
| SMILES | CCNCCNC(=O)CCNC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H21BrN4O2/c1-2-16-9-10-17-13(20)7-8-18-14(21)19-12-5-3-11(15)4-6-12/h3-6,16H,2,7-10H2,1H3,(H,17,20)(H2,18,19,21) |
| InChIKey | HWSAHVPFMFWHKP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|