C13H17ClN4O4 — CID 108512751
N'-(4-chloro-3-nitrophenyl)-N-[3-(dimethylamino)propyl]oxamide (PubChem CID 108512751) has the molecular formula C13H17ClN4O4 and a molecular weight of 328.76 g/mol. Its IUPAC name is N'-(4-chloro-3-nitrophenyl)-N-[3-(dimethylamino)propyl]oxamide.
| Compound Name | N'-(4-chloro-3-nitrophenyl)-N-[3-(dimethylamino)propyl]oxamide |
|---|---|
| PubChem CID | 108512751 |
| Molecular Formula | C13H17ClN4O4 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N'-(4-chloro-3-nitrophenyl)-N-[3-(dimethylamino)propyl]oxamide |
| SMILES | CN(C)CCCNC(=O)C(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H17ClN4O4/c1-17(2)7-3-6-15-12(19)13(20)16-9-4-5-10(14)11(8-9)18(21)22/h4-5,8H,3,6-7H2,1-2H3,(H,15,19)(H,16,20) |
| InChIKey | LWXQQNCSDBJBQX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|