C18H18N4O6S — CID 35832228
N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-6-methyl-4-oxo-3H-furo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 35832228) has the molecular formula C18H18N4O6S and a molecular weight of 418.43 g/mol. Its IUPAC name is N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-6-methyl-4-oxo-3H-furo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-6-methyl-4-oxo-3H-furo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 35832228 |
| Molecular Formula | C18H18N4O6S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-6-methyl-4-oxo-3H-furo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1oc2nc[nH]c(=O)c2c1C(=O)Nc1cc(S(=O)(=O)N2CCCC2)ccc1O |
| InChI | InChI=1S/C18H18N4O6S/c1-10-14(15-16(24)19-9-20-18(15)28-10)17(25)21-12-8-11(4-5-13(12)23)29(26,27)22-6-2-3-7-22/h4-5,8-9,23H,2-3,6-7H2,1H3,(H,21,25)(H,19,20,24) |
| InChIKey | BRVOBJJTHCCCMO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 145.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|