C16H15NO2S — CID 79001432
N-(4-hydroxy-2-methylphenyl)-2,3-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 79001432) has the molecular formula C16H15NO2S and a molecular weight of 285.37 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylphenyl)-2,3-dihydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(4-hydroxy-2-methylphenyl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 79001432 |
| Molecular Formula | C16H15NO2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-(4-hydroxy-2-methylphenyl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1cc(O)ccc1NC(=O)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C16H15NO2S/c1-10-8-12(18)6-7-13(10)17-16(19)15-9-11-4-2-3-5-14(11)20-15/h2-8,15,18H,9H2,1H3,(H,17,19) |
| InChIKey | LSUWBKNEWKGNPI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|