C15H14N2OS — CID 79207464
N-(2-aminophenyl)-2,3-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 79207464) has the molecular formula C15H14N2OS and a molecular weight of 270.36 g/mol. Its IUPAC name is N-(2-aminophenyl)-2,3-dihydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 79207464 |
| Molecular Formula | C15H14N2OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-(2-aminophenyl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C15H14N2OS/c16-11-6-2-3-7-12(11)17-15(18)14-9-10-5-1-4-8-13(10)19-14/h1-8,14H,9,16H2,(H,17,18) |
| InChIKey | QXKHLXMGQVTBGX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|