C15H13BrN2OS — CID 103909801
N-(6-bromo-2-methyl-3-pyridinyl)-2,3-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 103909801) has the molecular formula C15H13BrN2OS and a molecular weight of 349.25 g/mol. Its IUPAC name is N-(6-bromo-2-methyl-3-pyridinyl)-2,3-dihydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(6-bromo-2-methyl-3-pyridinyl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 103909801 |
| Molecular Formula | C15H13BrN2OS |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | N-(6-bromo-2-methyl-3-pyridinyl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1nc(Br)ccc1NC(=O)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C15H13BrN2OS/c1-9-11(6-7-14(16)17-9)18-15(19)13-8-10-4-2-3-5-12(10)20-13/h2-7,13H,8H2,1H3,(H,18,19) |
| InChIKey | BCYBNSMUEANFRG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|