C15H11Cl2NOS — CID 24592552
N-(2,4-dichlorophenyl)-2,3-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 24592552) has the molecular formula C15H11Cl2NOS and a molecular weight of 324.23 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2,3-dihydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 24592552 |
| Molecular Formula | C15H11Cl2NOS |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C15H11Cl2NOS/c16-10-5-6-12(11(17)8-10)18-15(19)14-7-9-3-1-2-4-13(9)20-14/h1-6,8,14H,7H2,(H,18,19) |
| InChIKey | IQHRJDVBGJLTQX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |