C16H14ClNOS — CID 114299762
N-[4-(chloromethyl)phenyl]-2,3-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 114299762) has the molecular formula C16H14ClNOS and a molecular weight of 303.81 g/mol. Its IUPAC name is N-[4-(chloromethyl)phenyl]-2,3-dihydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4-(chloromethyl)phenyl]-2,3-dihydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114299762 |
| Molecular Formula | C16H14ClNOS |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | N-[4-(chloromethyl)phenyl]-2,3-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(CCl)cc1)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C16H14ClNOS/c17-10-11-5-7-13(8-6-11)18-16(19)15-9-12-3-1-2-4-14(12)20-15/h1-8,15H,9-10H2,(H,18,19) |
| InChIKey | BVFDGEBDJIYMLZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|