C30H41N3O2 — CID 18636105
pentyl 1-cyano-4-[4-(5-heptylpyrimidin-2-yl)phenyl]cyclohexane-1-carboxylate (PubChem CID 18636105) has the molecular formula C30H41N3O2 and a molecular weight of 475.68 g/mol. Its IUPAC name is pentyl 1-cyano-4-[4-(5-heptylpyrimidin-2-yl)phenyl]cyclohexane-1-carboxylate.
| Compound Name | pentyl 1-cyano-4-[4-(5-heptylpyrimidin-2-yl)phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18636105 |
| Molecular Formula | C30H41N3O2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | pentyl 1-cyano-4-[4-(5-heptylpyrimidin-2-yl)phenyl]cyclohexane-1-carboxylate |
| SMILES | CCCCCCCc1cnc(-c2ccc(C3CCC(C#N)(C(=O)OCCCCC)CC3)cc2)nc1 |
| InChI | InChI=1S/C30H41N3O2/c1-3-5-7-8-9-11-24-21-32-28(33-22-24)27-14-12-25(13-15-27)26-16-18-30(23-31,19-17-26)29(34)35-20-10-6-4-2/h12-15,21-22,26H,3-11,16-20H2,1-2H3 |
| InChIKey | KKASQCZJZYXFIX-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|