C55H101NO10 — CID 176756951
2-[6-[4-(diethylamino)butanoyloxy]-7-(3-octylundecanoyloxy)-2,5,10,11-tetraoxatricyclo[6.2.1.04,9]undecan-1-yl]ethyl 3-octylundecanoate (PubChem CID 176756951) has the molecular formula C55H101NO10 and a molecular weight of 936.41 g/mol. Its IUPAC name is 2-[6-[4-(diethylamino)butanoyloxy]-7-(3-octylundecanoyloxy)-2,5,10,11-tetraoxatricyclo[6.2.1.04,9]undecan-1-yl]ethyl 3-octylundecanoate.
| Compound Name | 2-[6-[4-(diethylamino)butanoyloxy]-7-(3-octylundecanoyloxy)-2,5,10,11-tetraoxatricyclo[6.2.1.04,9]undecan-1-yl]ethyl 3-octylundecanoate |
|---|---|
| PubChem CID | 176756951 |
| Molecular Formula | C55H101NO10 |
| Molecular Weight | 936.41 g/mol |
| Exact Mass | 935.74 |
| IUPAC Name | 2-[6-[4-(diethylamino)butanoyloxy]-7-(3-octylundecanoyloxy)-2,5,10,11-tetraoxatricyclo[6.2.1.04,9]undecan-1-yl]ethyl 3-octylundecanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)CC(=O)OCCC12OCC3OC(OC(=O)CCCN(CC)CC)C(OC(=O)CC(CCCCCCCC)CCCCCCCC)C(O1)C3O2 |
| InChI | InChI=1S/C55H101NO10/c1-7-13-17-21-25-29-34-45(35-30-26-22-18-14-8-2)42-49(58)60-41-39-55-61-44-47-51(65-55)52(66-55)53(54(62-47)64-48(57)38-33-40-56(11-5)12-6)63-50(59)43-46(36-31-27-23-19-15-9-3)37-32-28-24-20-16-10-4/h45-47,51-54H,7-44H2,1-6H3 |
| InChIKey | DSOJJLZTOCESLI-UHFFFAOYSA-N |
| XLogP | 13.70 |
| TPSA | 119.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.41 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|