C51H104N2O8 — CID 177227185
4-[2-aminoethyl-[4-(4,4-dioctoxybutoxymethoxy)butyl]amino]butyl 4,4-dioctoxybutanoate (PubChem CID 177227185) has the molecular formula C51H104N2O8 and a molecular weight of 873.40 g/mol. Its IUPAC name is 4-[2-aminoethyl-[4-(4,4-dioctoxybutoxymethoxy)butyl]amino]butyl 4,4-dioctoxybutanoate.
| Compound Name | 4-[2-aminoethyl-[4-(4,4-dioctoxybutoxymethoxy)butyl]amino]butyl 4,4-dioctoxybutanoate |
|---|---|
| PubChem CID | 177227185 |
| Molecular Formula | C51H104N2O8 |
| Molecular Weight | 873.40 g/mol |
| Exact Mass | 872.78 |
| IUPAC Name | 4-[2-aminoethyl-[4-(4,4-dioctoxybutoxymethoxy)butyl]amino]butyl 4,4-dioctoxybutanoate |
| SMILES | CCCCCCCCOC(CCCOCOCCCCN(CCN)CCCCOC(=O)CCC(OCCCCCCCC)OCCCCCCCC)OCCCCCCCC |
| InChI | InChI=1S/C51H104N2O8/c1-5-9-13-17-21-27-44-58-50(59-45-28-22-18-14-10-6-2)34-33-42-56-48-55-41-31-25-38-53(40-37-52)39-26-32-43-57-49(54)35-36-51(60-46-29-23-19-15-11-7-3)61-47-30-24-20-16-12-8-4/h50-51H,5-48,52H2,1-4H3 |
| InChIKey | FFPOOUFUEINSKL-UHFFFAOYSA-N |
| XLogP | 13.06 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.40 |
| LogP ≤ 5 | 13.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|