C22H41NO7 — CID 177257164
[2-(butanoyloxymethyl)-3-[3-(diethylamino)propoxycarbonyloxy]propyl] hexanoate (PubChem CID 177257164) has the molecular formula C22H41NO7 and a molecular weight of 431.57 g/mol. Its IUPAC name is [2-(butanoyloxymethyl)-3-[3-(diethylamino)propoxycarbonyloxy]propyl] hexanoate.
| Compound Name | [2-(butanoyloxymethyl)-3-[3-(diethylamino)propoxycarbonyloxy]propyl] hexanoate |
|---|---|
| PubChem CID | 177257164 |
| Molecular Formula | C22H41NO7 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | [2-(butanoyloxymethyl)-3-[3-(diethylamino)propoxycarbonyloxy]propyl] hexanoate |
| SMILES | CCCCCC(=O)OCC(COC(=O)CCC)COC(=O)OCCCN(CC)CC |
| InChI | InChI=1S/C22H41NO7/c1-5-9-10-13-21(25)29-17-19(16-28-20(24)12-6-2)18-30-22(26)27-15-11-14-23(7-3)8-4/h19H,5-18H2,1-4H3 |
| InChIKey | NDQZDSQQUJONJY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|