C47H84NO10 — CID 171827823
CID 171827823 (PubChem CID 171827823) has the molecular formula C47H84NO10 and a molecular weight of 823.19 g/mol.
| Compound Name | CID 171827823 |
|---|---|
| PubChem CID | 171827823 |
| Molecular Formula | C47H84NO10 |
| Molecular Weight | 823.19 g/mol |
| Exact Mass | 822.61 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCC(C)OC(=O)CCCCCCCC(=O)OCC(COC(=O)CCC(OCCCCCCCC)C1=C[CH]1)COC(=O)OCCCN(CC)CC |
| InChI | InChI=1S/C47H84NO10/c1-6-10-12-14-16-18-22-27-40(5)58-46(51)29-24-20-17-19-23-28-44(49)55-37-41(39-57-47(52)54-36-26-34-48(8-3)9-4)38-56-45(50)33-32-43(42-30-31-42)53-35-25-21-15-13-11-7-2/h30-31,40-41,43H,6-29,32-39H2,1-5H3 |
| InChIKey | AIBXDLIPESJFGP-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.19 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|