C38H63NO9 — CID 167242259
6-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-[2-(3-tricyclo[3.3.1.03,7]nonanyl)acetyl]oxypropyl] 1-O-[(Z)-non-3-enyl] hexanedioate (PubChem CID 167242259) has the molecular formula C38H63NO9 and a molecular weight of 677.92 g/mol. Its IUPAC name is 6-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-[2-(3-tricyclo[3.3.1.03,7]nonanyl)acetyl]oxypropyl] 1-O-[(Z)-non-3-enyl] hexanedioate.
| Compound Name | 6-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-[2-(3-tricyclo[3.3.1.03,7]nonanyl)acetyl]oxypropyl] 1-O-[(Z)-non-3-enyl] hexanedioate |
|---|---|
| PubChem CID | 167242259 |
| Molecular Formula | C38H63NO9 |
| Molecular Weight | 677.92 g/mol |
| Exact Mass | 677.45 |
| IUPAC Name | 6-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-[2-(3-tricyclo[3.3.1.03,7]nonanyl)acetyl]oxypropyl] 1-O-[(Z)-non-3-enyl] hexanedioate |
| SMILES | CCCCC/C=C\CCOC(=O)CCCCC(=O)OCC(COC(=O)CC12CC3CC(CC1C3)C2)COC(=O)OCCCN(CC)CC |
| InChI | InChI=1S/C38H63NO9/c1-4-7-8-9-10-11-14-19-44-34(40)16-12-13-17-35(41)46-27-32(29-48-37(43)45-20-15-18-39(5-2)6-3)28-47-36(42)26-38-24-30-21-31(25-38)23-33(38)22-30/h10-11,30-33H,4-9,12-29H2,1-3H3/b11-10- |
| InChIKey | XXAYZHWFVVHTJH-KHPPLWFESA-N |
| XLogP | 7.42 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.92 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|