C44H71NO9 — CID 167242254
8-O-[2-[[2-(1-adamantyl)acetyl]oxymethyl]-3-[3-(diethylamino)propoxycarbonyloxy]propyl] 1-O-[2-(1-adamantyl)ethyl] octanedioate (PubChem CID 167242254) has the molecular formula C44H71NO9 and a molecular weight of 758.05 g/mol. Its IUPAC name is 8-O-[2-[[2-(1-adamantyl)acetyl]oxymethyl]-3-[3-(diethylamino)propoxycarbonyloxy]propyl] 1-O-[2-(1-adamantyl)ethyl] octanedioate.
| Compound Name | 8-O-[2-[[2-(1-adamantyl)acetyl]oxymethyl]-3-[3-(diethylamino)propoxycarbonyloxy]propyl] 1-O-[2-(1-adamantyl)ethyl] octanedioate |
|---|---|
| PubChem CID | 167242254 |
| Molecular Formula | C44H71NO9 |
| Molecular Weight | 758.05 g/mol |
| Exact Mass | 757.51 |
| IUPAC Name | 8-O-[2-[[2-(1-adamantyl)acetyl]oxymethyl]-3-[3-(diethylamino)propoxycarbonyloxy]propyl] 1-O-[2-(1-adamantyl)ethyl] octanedioate |
| SMILES | CCN(CC)CCCOC(=O)OCC(COC(=O)CCCCCCC(=O)OCCC12CC3CC(CC(C3)C1)C2)COC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C44H71NO9/c1-3-45(4-2)13-9-14-51-42(49)54-31-38(30-53-41(48)28-44-25-35-19-36(26-44)21-37(20-35)27-44)29-52-40(47)11-8-6-5-7-10-39(46)50-15-12-43-22-32-16-33(23-43)18-34(17-32)24-43/h32-38H,3-31H2,1-2H3 |
| InChIKey | IWMZJCBSSIMKRZ-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.05 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|