About 2-(diethylamino)ethyl 2-(1-adamantyl)acetate;iodoethane
2-(diethylamino)ethyl 2-(1-adamantyl)acetate;iodoethane (PubChem CID 23620960) has the molecular formula C20H36INO2
and a molecular weight of 449.42 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-(1-adamantyl)acetate;iodoethane.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 2-(1-adamantyl)acetate;iodoethane |
| PubChem CID | 23620960 |
| Molecular Formula | C20H36INO2 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 2-(diethylamino)ethyl 2-(1-adamantyl)acetate;iodoethane |
| SMILES | CCI.CCN(CC)CCOC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H31NO2.C2H5I/c1-3-19(4-2)5-6-21-17(20)13-18-10-14-7-15(11-18)9-16(8-14)12-18;1-2-3/h14-16H,3-13H2,1-2H3;2H2,1H3 |
| InChIKey | SGPIZDZYBJKFLM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl 2-(1-adamantyl)acetate;iodoethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 2-(1-adamantyl)acetate;iodoethane?
The IUPAC name of 2-(diethylamino)ethyl 2-(1-adamantyl)acetate;iodoethane (CID 23620960) is 2-(diethylamino)ethyl 2-(1-adamantyl)acetate;iodoethane.
What is the SMILES notation for 2-(diethylamino)ethyl 2-(1-adamantyl)acetate;iodoethane?
The canonical SMILES for 2-(diethylamino)ethyl 2-(1-adamantyl)acetate;iodoethane is CCI.CCN(CC)CCOC(=O)CC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 2-(diethylamino)ethyl 2-(1-adamantyl)acetate;iodoethane?
The InChIKey is SGPIZDZYBJKFLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31NO2.C2H5I/c1-3-19(4-2)5-6-21-17(20)13-18-10-14-7-15(11-18)9-16(8-14)12-18;1-2-3/h14-16H,3-13H2,1-2H3;2H2,1H3.
What are the key properties of 2-(diethylamino)ethyl 2-(1-adamantyl)acetate;iodoethane?
2-(diethylamino)ethyl 2-(1-adamantyl)acetate;iodoethane has a molecular weight of 449.42 g/mol, XLogP of 4.92, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 2-(1-adamantyl)acetate;iodoethane is sourced from PubChem (CID 23620960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).