C28H48INO10 — CID 162764422
8-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(7-iodo-7-oxoheptanoyl)oxypropyl] 1-O-methyl octanedioate (PubChem CID 162764422) has the molecular formula C28H48INO10 and a molecular weight of 685.59 g/mol. Its IUPAC name is 8-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(7-iodo-7-oxoheptanoyl)oxypropyl] 1-O-methyl octanedioate.
| Compound Name | 8-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(7-iodo-7-oxoheptanoyl)oxypropyl] 1-O-methyl octanedioate |
|---|---|
| PubChem CID | 162764422 |
| Molecular Formula | C28H48INO10 |
| Molecular Weight | 685.59 g/mol |
| Exact Mass | 685.23 |
| IUPAC Name | 8-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(7-iodo-7-oxoheptanoyl)oxypropyl] 1-O-methyl octanedioate |
| SMILES | CCN(CC)CCCOC(=O)OCC(COC(=O)CCCCCCC(=O)OC)COC(=O)CCCCCC(=O)I |
| InChI | InChI=1S/C28H48INO10/c1-4-30(5-2)18-13-19-37-28(35)40-22-23(21-39-27(34)17-12-8-9-14-24(29)31)20-38-26(33)16-11-7-6-10-15-25(32)36-3/h23H,4-22H2,1-3H3 |
| InChIKey | PUXQRSPFVPGKDL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|