C42H71NO6 — CID 161161049
[2-[3-(1-adamantyl)propanoyloxymethyl]-3-[4-(dimethylamino)butanoyloxy]propyl] (10Z,13Z)-nonadeca-10,13-dienoate (PubChem CID 161161049) has the molecular formula C42H71NO6 and a molecular weight of 686.03 g/mol. Its IUPAC name is [2-[3-(1-adamantyl)propanoyloxymethyl]-3-[4-(dimethylamino)butanoyloxy]propyl] (10Z,13Z)-nonadeca-10,13-dienoate.
| Compound Name | [2-[3-(1-adamantyl)propanoyloxymethyl]-3-[4-(dimethylamino)butanoyloxy]propyl] (10Z,13Z)-nonadeca-10,13-dienoate |
|---|---|
| PubChem CID | 161161049 |
| Molecular Formula | C42H71NO6 |
| Molecular Weight | 686.03 g/mol |
| Exact Mass | 685.53 |
| IUPAC Name | [2-[3-(1-adamantyl)propanoyloxymethyl]-3-[4-(dimethylamino)butanoyloxy]propyl] (10Z,13Z)-nonadeca-10,13-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(=O)OCC(COC(=O)CCCN(C)C)COC(=O)CCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C42H71NO6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21-39(44)47-32-38(33-48-40(45)22-20-25-43(2)3)34-49-41(46)23-24-42-29-35-26-36(30-42)28-37(27-35)31-42/h8-9,11-12,35-38H,4-7,10,13-34H2,1-3H3/b9-8-,12-11- |
| InChIKey | LWDUFNXPAZBQLJ-MURFETPASA-N |
| XLogP | 9.77 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.03 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|