C43H73NO6 — CID 159292861
[2-[4-(1-adamantyl)butanoyloxymethyl]-3-[4-(dimethylamino)butanoyloxy]propyl] (10Z,13Z)-nonadeca-10,13-dienoate (PubChem CID 159292861) has the molecular formula C43H73NO6 and a molecular weight of 700.06 g/mol. Its IUPAC name is [2-[4-(1-adamantyl)butanoyloxymethyl]-3-[4-(dimethylamino)butanoyloxy]propyl] (10Z,13Z)-nonadeca-10,13-dienoate.
| Compound Name | [2-[4-(1-adamantyl)butanoyloxymethyl]-3-[4-(dimethylamino)butanoyloxy]propyl] (10Z,13Z)-nonadeca-10,13-dienoate |
|---|---|
| PubChem CID | 159292861 |
| Molecular Formula | C43H73NO6 |
| Molecular Weight | 700.06 g/mol |
| Exact Mass | 699.54 |
| IUPAC Name | [2-[4-(1-adamantyl)butanoyloxymethyl]-3-[4-(dimethylamino)butanoyloxy]propyl] (10Z,13Z)-nonadeca-10,13-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(=O)OCC(COC(=O)CCCN(C)C)COC(=O)CCCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C43H73NO6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-40(45)48-33-39(35-50-42(47)24-21-26-44(2)3)34-49-41(46)23-20-25-43-30-36-27-37(31-43)29-38(28-36)32-43/h8-9,11-12,36-39H,4-7,10,13-35H2,1-3H3/b9-8-,12-11- |
| InChIKey | CHVLWRUQEOUDMF-MURFETPASA-N |
| XLogP | 10.16 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.06 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|