C48H83NO7 — CID 146490778
[2-[3-(dimethylamino)propoxycarbonyloxymethyl]-3-[(10Z)-nonadeca-10,12,13-trienoyl]oxypropyl] (9Z,12Z)-nonadeca-9,12-dienoate (PubChem CID 146490778) has the molecular formula C48H83NO7 and a molecular weight of 786.19 g/mol. Its IUPAC name is [2-[3-(dimethylamino)propoxycarbonyloxymethyl]-3-[(10Z)-nonadeca-10,12,13-trienoyl]oxypropyl] (9Z,12Z)-nonadeca-9,12-dienoate.
| Compound Name | [2-[3-(dimethylamino)propoxycarbonyloxymethyl]-3-[(10Z)-nonadeca-10,12,13-trienoyl]oxypropyl] (9Z,12Z)-nonadeca-9,12-dienoate |
|---|---|
| PubChem CID | 146490778 |
| Molecular Formula | C48H83NO7 |
| Molecular Weight | 786.19 g/mol |
| Exact Mass | 785.62 |
| IUPAC Name | [2-[3-(dimethylamino)propoxycarbonyloxymethyl]-3-[(10Z)-nonadeca-10,12,13-trienoyl]oxypropyl] (9Z,12Z)-nonadeca-9,12-dienoate |
| SMILES | CCCCCC=C=C/C=C\CCCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\C/C=C\CCCCCC)COC(=O)OCCCN(C)C |
| InChI | InChI=1S/C48H83NO7/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-46(50)54-42-45(44-56-48(52)53-41-37-40-49(3)4)43-55-47(51)39-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13,16-19,21-22,24,45H,5-12,14,20,23,25-44H2,1-4H3/b18-16-,21-19-,24-22- |
| InChIKey | KVSVTDXKCXBGOY-KYGSHNJISA-N |
| XLogP | 12.97 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.19 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|