C43H75NO4 — CID 123621221
[4-(dimethylamino)-1-octadeca-9,12-dienoyloxybutan-2-yl] nonadeca-9,10,13-trienoate (PubChem CID 123621221) has the molecular formula C43H75NO4 and a molecular weight of 670.08 g/mol. Its IUPAC name is [4-(dimethylamino)-1-octadeca-9,12-dienoyloxybutan-2-yl] nonadeca-9,10,13-trienoate.
| Compound Name | [4-(dimethylamino)-1-octadeca-9,12-dienoyloxybutan-2-yl] nonadeca-9,10,13-trienoate |
|---|---|
| PubChem CID | 123621221 |
| Molecular Formula | C43H75NO4 |
| Molecular Weight | 670.08 g/mol |
| Exact Mass | 669.57 |
| IUPAC Name | [4-(dimethylamino)-1-octadeca-9,12-dienoyloxybutan-2-yl] nonadeca-9,10,13-trienoate |
| SMILES | CCCCCC=CCC=C=CCCCCCCCC(=O)OC(CCN(C)C)COC(=O)CCCCCCCC=CCC=CCCCCC |
| InChI | InChI=1S/C43H75NO4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-43(46)48-41(38-39-44(3)4)40-47-42(45)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-20,22-23,41H,5-12,17-18,24-40H2,1-4H3 |
| InChIKey | QIUSVTSDAADFJM-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.08 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|