C42H82N2O5 — CID 171085173
6-[4-acetamidobutyl-[6-(2-methylheptanoyloxy)hexyl]amino]hexyl 2-hexyldecanoate (PubChem CID 171085173) has the molecular formula C42H82N2O5 and a molecular weight of 695.13 g/mol. Its IUPAC name is 6-[4-acetamidobutyl-[6-(2-methylheptanoyloxy)hexyl]amino]hexyl 2-hexyldecanoate.
| Compound Name | 6-[4-acetamidobutyl-[6-(2-methylheptanoyloxy)hexyl]amino]hexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 171085173 |
| Molecular Formula | C42H82N2O5 |
| Molecular Weight | 695.13 g/mol |
| Exact Mass | 694.62 |
| IUPAC Name | 6-[4-acetamidobutyl-[6-(2-methylheptanoyloxy)hexyl]amino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCN(CCCCCCOC(=O)C(C)CCCCC)CCCCNC(C)=O |
| InChI | InChI=1S/C42H82N2O5/c1-6-9-12-14-15-22-31-40(30-21-13-10-7-2)42(47)49-37-28-19-17-25-34-44(35-26-23-32-43-39(5)45)33-24-16-18-27-36-48-41(46)38(4)29-20-11-8-3/h38,40H,6-37H2,1-5H3,(H,43,45) |
| InChIKey | JFJKIWNCCIWFKJ-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.13 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|