C54H108N2O6 — CID 168891963
4-hexyldecyl 8-[2-[2-(2-aminoethoxy)ethoxy]ethyl-[8-(4-hexyldecoxy)-8-oxooctyl]amino]octanoate (PubChem CID 168891963) has the molecular formula C54H108N2O6 and a molecular weight of 881.47 g/mol. Its IUPAC name is 4-hexyldecyl 8-[2-[2-(2-aminoethoxy)ethoxy]ethyl-[8-(4-hexyldecoxy)-8-oxooctyl]amino]octanoate.
| Compound Name | 4-hexyldecyl 8-[2-[2-(2-aminoethoxy)ethoxy]ethyl-[8-(4-hexyldecoxy)-8-oxooctyl]amino]octanoate |
|---|---|
| PubChem CID | 168891963 |
| Molecular Formula | C54H108N2O6 |
| Molecular Weight | 881.47 g/mol |
| Exact Mass | 880.82 |
| IUPAC Name | 4-hexyldecyl 8-[2-[2-(2-aminoethoxy)ethoxy]ethyl-[8-(4-hexyldecoxy)-8-oxooctyl]amino]octanoate |
| SMILES | CCCCCCC(CCCCCC)CCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OCCCC(CCCCCC)CCCCCC)CCOCCOCCN |
| InChI | InChI=1S/C54H108N2O6/c1-5-9-13-23-33-51(34-24-14-10-6-2)37-31-45-61-53(57)39-27-19-17-21-29-42-56(44-48-60-50-49-59-47-41-55)43-30-22-18-20-28-40-54(58)62-46-32-38-52(35-25-15-11-7-3)36-26-16-12-8-4/h51-52H,5-50,55H2,1-4H3 |
| InChIKey | IBUXEQDFUPMWLM-UHFFFAOYSA-N |
| XLogP | 14.72 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.47 |
| LogP ≤ 5 | 14.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|