C50H100N2O6 — CID 168892108
4-pentylnonyl 8-[2-[2-(2-aminoethoxy)ethoxy]ethyl-[8-oxo-8-(4-pentylnonoxy)octyl]amino]octanoate (PubChem CID 168892108) has the molecular formula C50H100N2O6 and a molecular weight of 825.36 g/mol. Its IUPAC name is 4-pentylnonyl 8-[2-[2-(2-aminoethoxy)ethoxy]ethyl-[8-oxo-8-(4-pentylnonoxy)octyl]amino]octanoate.
| Compound Name | 4-pentylnonyl 8-[2-[2-(2-aminoethoxy)ethoxy]ethyl-[8-oxo-8-(4-pentylnonoxy)octyl]amino]octanoate |
|---|---|
| PubChem CID | 168892108 |
| Molecular Formula | C50H100N2O6 |
| Molecular Weight | 825.36 g/mol |
| Exact Mass | 824.76 |
| IUPAC Name | 4-pentylnonyl 8-[2-[2-(2-aminoethoxy)ethoxy]ethyl-[8-oxo-8-(4-pentylnonoxy)octyl]amino]octanoate |
| SMILES | CCCCCC(CCCCC)CCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OCCCC(CCCCC)CCCCC)CCOCCOCCN |
| InChI | InChI=1S/C50H100N2O6/c1-5-9-19-29-47(30-20-10-6-2)33-27-41-57-49(53)35-23-15-13-17-25-38-52(40-44-56-46-45-55-43-37-51)39-26-18-14-16-24-36-50(54)58-42-28-34-48(31-21-11-7-3)32-22-12-8-4/h47-48H,5-46,51H2,1-4H3 |
| InChIKey | GDCXSKORRFDRHK-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.36 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|