C11H20N2O4S — CID 113250617
methyl 3-[hex-5-yn-3-ylsulfamoyl(methyl)amino]propanoate (PubChem CID 113250617) has the molecular formula C11H20N2O4S and a molecular weight of 276.36 g/mol. Its IUPAC name is methyl 3-[hex-5-yn-3-ylsulfamoyl(methyl)amino]propanoate.
| Compound Name | methyl 3-[hex-5-yn-3-ylsulfamoyl(methyl)amino]propanoate |
|---|---|
| PubChem CID | 113250617 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | methyl 3-[hex-5-yn-3-ylsulfamoyl(methyl)amino]propanoate |
| SMILES | C#CCC(CC)NS(=O)(=O)N(C)CCC(=O)OC |
| InChI | InChI=1S/C11H20N2O4S/c1-5-7-10(6-2)12-18(15,16)13(3)9-8-11(14)17-4/h1,10,12H,6-9H2,2-4H3 |
| InChIKey | DHDFUMPWDFDLLS-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|