C8H14N2O4S — CID 114466108
methyl N-(hex-5-yn-3-ylsulfamoyl)carbamate (PubChem CID 114466108) has the molecular formula C8H14N2O4S and a molecular weight of 234.28 g/mol. Its IUPAC name is methyl N-(hex-5-yn-3-ylsulfamoyl)carbamate.
| Compound Name | methyl N-(hex-5-yn-3-ylsulfamoyl)carbamate |
|---|---|
| PubChem CID | 114466108 |
| Molecular Formula | C8H14N2O4S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | methyl N-(hex-5-yn-3-ylsulfamoyl)carbamate |
| SMILES | C#CCC(CC)NS(=O)(=O)NC(=O)OC |
| InChI | InChI=1S/C8H14N2O4S/c1-4-6-7(5-2)9-15(12,13)10-8(11)14-3/h1,7,9H,5-6H2,2-3H3,(H,10,11) |
| InChIKey | PVWZROZDHCDADD-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|