C6H13ClN2O5S — CID 106185569
methyl N-[(1-chloro-3-methoxypropan-2-yl)sulfamoyl]carbamate (PubChem CID 106185569) has the molecular formula C6H13ClN2O5S and a molecular weight of 260.70 g/mol. Its IUPAC name is methyl N-[(1-chloro-3-methoxypropan-2-yl)sulfamoyl]carbamate.
| Compound Name | methyl N-[(1-chloro-3-methoxypropan-2-yl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 106185569 |
| Molecular Formula | C6H13ClN2O5S |
| Molecular Weight | 260.70 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | methyl N-[(1-chloro-3-methoxypropan-2-yl)sulfamoyl]carbamate |
| SMILES | COCC(CCl)NS(=O)(=O)NC(=O)OC |
| InChI | InChI=1S/C6H13ClN2O5S/c1-13-4-5(3-7)8-15(11,12)9-6(10)14-2/h5,8H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | NJJBRBVPFYRFGZ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.70 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|