C7H15ClN2O5S — CID 106158321
methyl N-[(4-chloro-1-methoxybutan-2-yl)sulfamoyl]carbamate (PubChem CID 106158321) has the molecular formula C7H15ClN2O5S and a molecular weight of 274.73 g/mol. Its IUPAC name is methyl N-[(4-chloro-1-methoxybutan-2-yl)sulfamoyl]carbamate.
| Compound Name | methyl N-[(4-chloro-1-methoxybutan-2-yl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 106158321 |
| Molecular Formula | C7H15ClN2O5S |
| Molecular Weight | 274.73 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | methyl N-[(4-chloro-1-methoxybutan-2-yl)sulfamoyl]carbamate |
| SMILES | COCC(CCCl)NS(=O)(=O)NC(=O)OC |
| InChI | InChI=1S/C7H15ClN2O5S/c1-14-5-6(3-4-8)9-16(12,13)10-7(11)15-2/h6,9H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | TXXAZJXZGNBTDD-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.73 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|