C8H21N3O3S — CID 106153951
4-methoxy-3-N-(propan-2-ylsulfamoyl)butane-1,3-diamine (PubChem CID 106153951) has the molecular formula C8H21N3O3S and a molecular weight of 239.34 g/mol. Its IUPAC name is 4-methoxy-3-N-(propan-2-ylsulfamoyl)butane-1,3-diamine.
| Compound Name | 4-methoxy-3-N-(propan-2-ylsulfamoyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 106153951 |
| Molecular Formula | C8H21N3O3S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 4-methoxy-3-N-(propan-2-ylsulfamoyl)butane-1,3-diamine |
| SMILES | COCC(CCN)NS(=O)(=O)NC(C)C |
| InChI | InChI=1S/C8H21N3O3S/c1-7(2)10-15(12,13)11-8(4-5-9)6-14-3/h7-8,10-11H,4-6,9H2,1-3H3 |
| InChIKey | ZHRDNHYHCVLKLZ-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |