C10H20N4O3S — CID 106153983
N-(4-amino-1-methoxybutan-2-yl)-1-ethylimidazole-4-sulfonamide (PubChem CID 106153983) has the molecular formula C10H20N4O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is N-(4-amino-1-methoxybutan-2-yl)-1-ethylimidazole-4-sulfonamide.
| Compound Name | N-(4-amino-1-methoxybutan-2-yl)-1-ethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 106153983 |
| Molecular Formula | C10H20N4O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-(4-amino-1-methoxybutan-2-yl)-1-ethylimidazole-4-sulfonamide |
| SMILES | CCn1cnc(S(=O)(=O)NC(CCN)COC)c1 |
| InChI | InChI=1S/C10H20N4O3S/c1-3-14-6-10(12-8-14)18(15,16)13-9(4-5-11)7-17-2/h6,8-9,13H,3-5,7,11H2,1-2H3 |
| InChIKey | AYYRZQPLBOGOAT-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |