C10H20N4O3S — CID 114150900
N-(4-amino-1-methoxybutan-2-yl)-2-ethyl-1H-imidazole-5-sulfonamide (PubChem CID 114150900) has the molecular formula C10H20N4O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is N-(4-amino-1-methoxybutan-2-yl)-2-ethyl-1H-imidazole-5-sulfonamide.
| Compound Name | N-(4-amino-1-methoxybutan-2-yl)-2-ethyl-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 114150900 |
| Molecular Formula | C10H20N4O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-(4-amino-1-methoxybutan-2-yl)-2-ethyl-1H-imidazole-5-sulfonamide |
| SMILES | CCc1ncc(S(=O)(=O)NC(CCN)COC)[nH]1 |
| InChI | InChI=1S/C10H20N4O3S/c1-3-9-12-6-10(13-9)18(15,16)14-8(4-5-11)7-17-2/h6,8,14H,3-5,7,11H2,1-2H3,(H,12,13) |
| InChIKey | WTQXENFCTBTBNN-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |