C10H18BrN3O3S — CID 106245580
N-(3-bromo-4-methoxybutyl)-2-ethyl-1H-imidazole-5-sulfonamide (PubChem CID 106245580) has the molecular formula C10H18BrN3O3S and a molecular weight of 340.24 g/mol. Its IUPAC name is N-(3-bromo-4-methoxybutyl)-2-ethyl-1H-imidazole-5-sulfonamide.
| Compound Name | N-(3-bromo-4-methoxybutyl)-2-ethyl-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 106245580 |
| Molecular Formula | C10H18BrN3O3S |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | N-(3-bromo-4-methoxybutyl)-2-ethyl-1H-imidazole-5-sulfonamide |
| SMILES | CCc1ncc(S(=O)(=O)NCCC(Br)COC)[nH]1 |
| InChI | InChI=1S/C10H18BrN3O3S/c1-3-9-12-6-10(14-9)18(15,16)13-5-4-8(11)7-17-2/h6,8,13H,3-5,7H2,1-2H3,(H,12,14) |
| InChIKey | KPLYELWBYCBLJT-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|