C7H12BrN3O2S — CID 114298250
N-(2-bromoethyl)-2-ethyl-1H-imidazole-5-sulfonamide (PubChem CID 114298250) has the molecular formula C7H12BrN3O2S and a molecular weight of 282.16 g/mol. Its IUPAC name is N-(2-bromoethyl)-2-ethyl-1H-imidazole-5-sulfonamide.
| Compound Name | N-(2-bromoethyl)-2-ethyl-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 114298250 |
| Molecular Formula | C7H12BrN3O2S |
| Molecular Weight | 282.16 g/mol |
| Exact Mass | 280.98 |
| IUPAC Name | N-(2-bromoethyl)-2-ethyl-1H-imidazole-5-sulfonamide |
| SMILES | CCc1ncc(S(=O)(=O)NCCBr)[nH]1 |
| InChI | InChI=1S/C7H12BrN3O2S/c1-2-6-9-5-7(11-6)14(12,13)10-4-3-8/h5,10H,2-4H2,1H3,(H,9,11) |
| InChIKey | QBWUXWIHIQLVNZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.16 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|