C10H19N3O3S2 — CID 106306704
2-ethyl-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1H-imidazole-5-sulfonamide (PubChem CID 106306704) has the molecular formula C10H19N3O3S2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-ethyl-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1H-imidazole-5-sulfonamide.
| Compound Name | 2-ethyl-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 106306704 |
| Molecular Formula | C10H19N3O3S2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-ethyl-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1H-imidazole-5-sulfonamide |
| SMILES | CCc1ncc(S(=O)(=O)NCCSCCCO)[nH]1 |
| InChI | InChI=1S/C10H19N3O3S2/c1-2-9-11-8-10(13-9)18(15,16)12-4-7-17-6-3-5-14/h8,12,14H,2-7H2,1H3,(H,11,13) |
| InChIKey | FCXVQBOESFOVTN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|