C10H20N4O3S — CID 113430471
2-ethyl-N-[2-(2-hydroxypropylamino)ethyl]-1H-imidazole-5-sulfonamide (PubChem CID 113430471) has the molecular formula C10H20N4O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-ethyl-N-[2-(2-hydroxypropylamino)ethyl]-1H-imidazole-5-sulfonamide.
| Compound Name | 2-ethyl-N-[2-(2-hydroxypropylamino)ethyl]-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 113430471 |
| Molecular Formula | C10H20N4O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-ethyl-N-[2-(2-hydroxypropylamino)ethyl]-1H-imidazole-5-sulfonamide |
| SMILES | CCc1ncc(S(=O)(=O)NCCNCC(C)O)[nH]1 |
| InChI | InChI=1S/C10H20N4O3S/c1-3-9-12-7-10(14-9)18(16,17)13-5-4-11-6-8(2)15/h7-8,11,13,15H,3-6H2,1-2H3,(H,12,14) |
| InChIKey | KLDXDSAURMFBQT-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|