C8H16N4O3S — CID 104594035
N-[2-(2-hydroxypropylamino)ethyl]-1H-imidazole-5-sulfonamide (PubChem CID 104594035) has the molecular formula C8H16N4O3S and a molecular weight of 248.31 g/mol. Its IUPAC name is N-[2-(2-hydroxypropylamino)ethyl]-1H-imidazole-5-sulfonamide.
| Compound Name | N-[2-(2-hydroxypropylamino)ethyl]-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 104594035 |
| Molecular Formula | C8H16N4O3S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | N-[2-(2-hydroxypropylamino)ethyl]-1H-imidazole-5-sulfonamide |
| SMILES | CC(O)CNCCNS(=O)(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C8H16N4O3S/c1-7(13)4-9-2-3-12-16(14,15)8-5-10-6-11-8/h5-7,9,12-13H,2-4H2,1H3,(H,10,11) |
| InChIKey | WJQPDXQUIHOWTD-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|