C10H20N4O2S — CID 114168541
N-(2-amino-3-ethylpentyl)-1H-imidazole-5-sulfonamide (PubChem CID 114168541) has the molecular formula C10H20N4O2S and a molecular weight of 260.36 g/mol. Its IUPAC name is N-(2-amino-3-ethylpentyl)-1H-imidazole-5-sulfonamide.
| Compound Name | N-(2-amino-3-ethylpentyl)-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 114168541 |
| Molecular Formula | C10H20N4O2S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-(2-amino-3-ethylpentyl)-1H-imidazole-5-sulfonamide |
| SMILES | CCC(CC)C(N)CNS(=O)(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C10H20N4O2S/c1-3-8(4-2)9(11)5-14-17(15,16)10-6-12-7-13-10/h6-9,14H,3-5,11H2,1-2H3,(H,12,13) |
| InChIKey | WFBCVFALZGBFGM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |