C9H16N4O3S — CID 103824162
3-(1H-imidazol-5-ylsulfonylamino)-N,2,2-trimethylpropanamide (PubChem CID 103824162) has the molecular formula C9H16N4O3S and a molecular weight of 260.32 g/mol. Its IUPAC name is 3-(1H-imidazol-5-ylsulfonylamino)-N,2,2-trimethylpropanamide.
| Compound Name | 3-(1H-imidazol-5-ylsulfonylamino)-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 103824162 |
| Molecular Formula | C9H16N4O3S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 3-(1H-imidazol-5-ylsulfonylamino)-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNS(=O)(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C9H16N4O3S/c1-9(2,8(14)10-3)5-13-17(15,16)7-4-11-6-12-7/h4,6,13H,5H2,1-3H3,(H,10,14)(H,11,12) |
| InChIKey | QSQPSSRWHAQMJH-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |