C11H19N5O3S — CID 106278343
3-[(4-hydrazinyl-3-pyridinyl)sulfonylamino]-N,2,2-trimethylpropanamide (PubChem CID 106278343) has the molecular formula C11H19N5O3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 3-[(4-hydrazinyl-3-pyridinyl)sulfonylamino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(4-hydrazinyl-3-pyridinyl)sulfonylamino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106278343 |
| Molecular Formula | C11H19N5O3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-[(4-hydrazinyl-3-pyridinyl)sulfonylamino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNS(=O)(=O)c1cnccc1NN |
| InChI | InChI=1S/C11H19N5O3S/c1-11(2,10(17)13-3)7-15-20(18,19)9-6-14-5-4-8(9)16-12/h4-6,15H,7,12H2,1-3H3,(H,13,17)(H,14,16) |
| InChIKey | LLTLNVHTGMNJGE-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|