C10H18N6O3S — CID 83121658
3-[2-[(4-hydrazinyl-3-pyridinyl)sulfonylamino]ethyl]-1,1-dimethylurea (PubChem CID 83121658) has the molecular formula C10H18N6O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-[2-[(4-hydrazinyl-3-pyridinyl)sulfonylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(4-hydrazinyl-3-pyridinyl)sulfonylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83121658 |
| Molecular Formula | C10H18N6O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-[2-[(4-hydrazinyl-3-pyridinyl)sulfonylamino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNS(=O)(=O)c1cnccc1NN |
| InChI | InChI=1S/C10H18N6O3S/c1-16(2)10(17)13-5-6-14-20(18,19)9-7-12-4-3-8(9)15-11/h3-4,7,14H,5-6,11H2,1-2H3,(H,12,15)(H,13,17) |
| InChIKey | WOQNLWYGYZEAJN-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|