C9H15N3O4S — CID 79806947
2-ethyl-2-(1H-imidazol-5-ylsulfonylamino)butanoic acid (PubChem CID 79806947) has the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. Its IUPAC name is 2-ethyl-2-(1H-imidazol-5-ylsulfonylamino)butanoic acid.
| Compound Name | 2-ethyl-2-(1H-imidazol-5-ylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 79806947 |
| Molecular Formula | C9H15N3O4S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-ethyl-2-(1H-imidazol-5-ylsulfonylamino)butanoic acid |
| SMILES | CCC(CC)(NS(=O)(=O)c1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C9H15N3O4S/c1-3-9(4-2,8(13)14)12-17(15,16)7-5-10-6-11-7/h5-6,12H,3-4H2,1-2H3,(H,10,11)(H,13,14) |
| InChIKey | WIWAGPDGICOZFX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |